|
MSDS Sheets
Material Safety Data Sheets (MSDS) list information relevant to the physical, chemical and toxicological makeup of a particular substance. They describe a material's physical properties, outline safe handling precautions, and provide instructions for first-aid and emergency procedures in accordance with OSHA guidelines.
If you are having trouble downloading or viewing PDF's, you may need to install or upgrade Adobe Acrobat Reader.
|
| |
PotashCorp MSDS number: |
1 |
| |
Common Name |
Potash |
| |
Formula: |
KCl |
| |
Synonym: |
Muriate of Potash |
| |
Use: |
Fertilizer |
| |
Revision Date: |
2006-12-31 |
|
|
DAP (Diammonium Phosphate) |
|
| |
PotashCorp MSDS number: |
4 |
| |
Common Name |
Diammonium Phosphate |
| |
Formula: |
(NH4)2HPO4 |
| |
Synonym: |
DAP, DAPLG |
| |
Use: |
Agricultural |
| |
Revision Date: |
2007-02-28 |
|
|
MAP (Monoammonium Phosphate) |
|
| |
PotashCorp MSDS number: |
5 |
| |
Common Name |
Monoammonium Phosphate |
| |
Formula: |
(NH4)H2PO4 |
| |
Synonym: |
MAP |
| |
Use: |
Agricultural |
| |
Revision Date: |
2007-02-28 |
|
|
Defluorinated Phosphate (18.0% P) |
|
| |
PotashCorp MSDS number: |
8 |
| |
Common Name |
Tricalcium Phosphate |
| |
Formula: |
Ca3(PO4)2 |
| |
Synonym: |
DFP |
| |
Use: |
Animal and Poultry feeds |
| |
Revision Date: |
2008-10-20 |
|
|
| |
PotashCorp MSDS number: |
9 |
| |
Common Name |
Phosphogypsum |
| |
Formula: |
CaSO4, 2H2O |
| |
Synonym: |
Gyp, Gypsum |
| |
Use: |
Agricultural |
| |
Revision Date: |
2007-02-28 |
|
|
Ammonium Nitrate - Industrial |
|
| |
PotashCorp MSDS number: |
11 |
| |
Common Name |
Ammonium Nitrate - Industrial Grade |
| |
Formula: |
NH4 NO3 |
| |
Synonym: |
Low Density Ammonium Nitrate |
| |
Use: |
Industrial |
| |
Revision Date: |
2006-10-01 |
|
|
| |
PotashCorp MSDS number: |
13 |
| |
Common Name |
Urea, Dry |
| |
Formula: |
CO(NH2)2 |
| |
Synonym: |
Urea Prills, Urea Granular |
| |
Use: |
Industrial, Agricultural, Feed |
| |
Revision Date: |
2007-02-28 |
|
|
Dicalcium Phosphate (18.5% P) |
|
| |
PotashCorp MSDS number: |
16 |
| |
Common Name |
Calcium Phosphate Dibasic Dihydrate |
| |
Formula: |
CaHPO4.2H2O+Ca(H2PO4)2.H2O |
| |
Synonym: |
DCP Dical |
| |
Use: |
Animal and Poultry feeds |
| |
Revision Date: |
2007-03-09 |
|
|
Monocalcium Phosphate (21.0% P) |
|
| |
PotashCorp MSDS number: |
17 |
| |
Common Name |
Calcium Phosphate Monobasic Dihydrate |
| |
Formula: |
Ca(H2PO4)2.H2O+CaHPO4.2H2O |
| |
Synonym: |
MCP, Monocal, MCPC |
| |
Use: |
Animal and Poultry Feeds |
| |
Revision Date: |
2006-12-31 |
|
|
| |
PotashCorp MSDS number: |
20 |
| |
Common Name |
K-Prills |
| |
Formula: |
KCl |
| |
Synonym: |
Muriate of Potash |
| |
Use: |
Fertilizer |
| |
Revision Date: |
2006-10-01 |
|
|
Feed MAP (Monoammonium Phosphate) |
|
| |
PotashCorp MSDS number: |
21 |
| |
Common Name |
Ammonium Phosphate, Monobasic |
| |
Formula: |
(NH4)H2PO4 |
| |
Synonym: |
MAPFD |
| |
Use: |
Animal Feed |
| |
Revision Date: |
2007-02-28 |
|
|
Feed DAP (Diammonium Phosphate) |
|
| |
PotashCorp MSDS number: |
23 |
| |
Common Name |
Diammonium Phosphate |
| |
Formula: |
(NH4)2HPO4 |
| |
Synonym: |
DAPFD |
| |
Use: |
Animal Feed |
| |
Revision Date: |
2007-02-28 |
|
|
White Soluble Muriate of Potash |
|
| |
PotashCorp MSDS number: |
24 |
| |
Common Name |
Potassium Chloride |
| |
Formula: |
KCl |
| |
Synonym: |
Potash |
| |
Use: |
Soluble Fertilizer/Industrial Chemical |
| |
Revision Date: |
2006-10-01 |
|
|
| |
PotashCorp MSDS number: |
25 |
| |
Common Name |
Potash |
| |
Formula: |
KCl |
| |
Synonym: |
Muriate of Potash |
| |
Use: |
Industrial Chicklets |
| |
Revision Date: |
2006-12-31 |
|
|
| |
PotashCorp MSDS number: |
30 |
| |
Common Name |
Anhydrous Ammonia |
| |
Formula: |
NH3 |
| |
Synonym: |
Ammonia |
| |
Use: |
Industrial, Agricultural |
| |
Revision Date: |
2008-04-14 |
|
|
| |
PotashCorp MSDS number: |
31 |
| |
Common Name |
Aqua Ammonia, Ammonium Hydroxide |
| |
Formula: |
NH4OH/H2O |
| |
Synonym: |
Aqueous Ammonia, Ammoniacal Liquid |
| |
Use: |
Industrial |
| |
Revision Date: |
2006-12-31 |
|
|
| |
PotashCorp MSDS number: |
32 |
| |
Common Name |
Nitric Acid |
| |
Formula: |
HNO3 |
| |
Synonym: |
Nitric Acid |
| |
Use: |
Industrial |
| |
Revision Date: |
2006-12-31 |
|
|
Ammonium Nitrate Solution |
|
| |
PotashCorp MSDS number: |
33 |
| |
Common Name |
Ammonium Nitrate Solution |
| |
Formula: |
NH4NO3/ H2O4 |
| |
Synonym: |
Aqueous Solutions of Ammonium |
| |
Use: |
Industrial |
| |
Revision Date: |
2006-12-31 |
|
|
Suran® (Nitrogen/Sulfur Fertilizer Solutions) |
|
| |
PotashCorp MSDS number: |
34 |
| |
Common Name |
Suran Solution of Ammonium Nitrate, Ammonium Thiosulfate, Sulfur |
| |
Formula: |
NH4NO3(NH4)2SO4, CO(NH2)2 |
| |
Synonym: |
Suran, Nitrogen Sulfur Fertilizer Solution |
| |
Use: |
Agricultural |
| |
Revision Date: |
2007-05-21 |
|
|
URAN® (Nitrogen Fertilizer Solution) |
|
| |
PotashCorp MSDS number: |
35 |
| |
Common Name |
Urea Ammonium Nitrate Solution |
| |
Formula: |
CO(NH2)2 NH4NO3 |
| |
Synonym: |
Nitrogen Fertilizer Solution |
| |
Use: |
Agricultural |
| |
Revision Date: |
2007-05-21 |
|
|
| |
PotashCorp MSDS number: |
36 |
| |
Common Name |
Aqueous solutions of Urea (30% - 70%) |
| |
Formula: |
CO(NH2)2 |
| |
Synonym: |
Urea Solution |
| |
Use: |
Industrial, Animal Feed |
| |
Revision Date: |
2009-04-22 |
|
|
| |
PotashCorp MSDS number: |
37 |
| |
Common Name |
Sulfuric Acid |
| |
Formula: |
H2SO4(in H2O) |
| |
Synonym: |
SULFAC (93 & 99), SULAC |
| |
Use: |
Industrial |
| |
Revision Date: |
2006-12-31 |
|
|
| |
PotashCorp MSDS number: |
41 |
| |
Common Name |
S25 Solution |
| |
Formula: |
NH4NO3(NH4)2SO4, CO(NH2)2, H2O |
| |
Synonym: |
Ammonium Nitrate, Ammonium Sulfate, Urea Solution |
| |
Use: |
Agricultural |
| |
Revision Date: |
2007-05-21 |
|
|
| |
PotashCorp MSDS number: |
43 |
| |
Common Name |
Carbon Dioxide |
| |
Formula: |
CO2 |
| |
Synonym: |
Carbonic Anhydride, Carbonic Acid Gas |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-02-12 |
|
|
| |
PotashCorp MSDS number: |
44 |
| |
Common Name |
Noxout-A, Noxout |
| |
Formula: |
Urea, Water and Proprietary Chemicals |
| |
Synonym: |
Aqueous Solution of Synthesized Urea |
| |
Use: |
Industrial |
| |
Revision Date: |
2006-12-31 |
|
|
N-SULF-V® (Nitrogen / Sulfur Fertilizer Solution) |
|
| |
PotashCorp MSDS number: |
45 |
| |
Common Name |
N-SULF-V® |
| |
Formula: |
NH4NO3 (NH4)2S04, CO(NH2)2, H2O |
| |
Synonym: |
Nitrogen /Sulfur Fertilizer Solution |
| |
Use: |
Agricultural |
| |
Revision Date: |
2008-10-27 |
|
|
| |
PotashCorp MSDS number: |
46 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
AMMGA, BDMGA |
| |
Use: |
Industrial, Agricultural |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid - Green MGA and Industrial |
|
| |
PotashCorp MSDS number: |
47 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
GRMGA, PAPMGA, HQ54, GQ54, PHOS54, PHOS60 |
| |
Use: |
Industrial, Agricultural |
| |
Revision Date: |
2007-02-28 |
|
|
Green Superphosphoric Acid |
|
| |
PotashCorp MSDS number: |
49 |
| |
Common Name |
Superphosphoric Acid |
| |
Formula: |
Superphosphoric acid is a blend of orthophosphoric and polyphosphoric acid. Polyphosphoric acid is composed of linear polyphosphate species always including pyrophosphate with presence and amounts of tripolyphosphate, tetrapolyphosphate or longer chains dependent upon total phosphate concentration. |
| |
Synonym: |
LOMAG, SPA |
| |
Use: |
Agricultural, Animal Feed, Industrial |
| |
Revision Date: |
2007-01-16 |
|
|
Black Superphosphoric Acid |
|
| |
PotashCorp MSDS number: |
50 |
| |
Common Name |
Superphosphoric Acid |
| |
Formula: |
Superphosphoric acid is a blend of orthophosphoric and polyphosphoric acid. Polyphosphoric acid is composed of linear polyphosphate species always including pyrophosphate with presence and amounts of tripolyphosphate, tetrapolyphosphate or longer chains dependent upon total phosphate concentration. |
| |
Synonym: |
BSPA |
| |
Use: |
Agricultural, Animal Feed, Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Ammonium Polyphosphate Solution |
|
| |
PotashCorp MSDS number: |
51 |
| |
Common Name |
Ammonium Polyphosphate Solution |
| |
Formula: |
Mixture |
| |
Synonym: |
POLY10, POLY11 |
| |
Use: |
Agricultural, Animal Feed, Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
| |
PotashCorp MSDS number: |
52 |
| |
Common Name |
Hydrofluosilicic Acid |
| |
Formula: |
H2SiF6 |
| |
Synonym: |
HFSA |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Defluorinated Phosphoric Acid Amber Feed Grade |
|
| |
PotashCorp MSDS number: |
55 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
DFMGA, DFMGAA |
| |
Use: |
Animal Feed |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid Green Feed Grade |
|
| |
PotashCorp MSDS number: |
56 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
HQ54 |
| |
Use: |
Animal Feed |
| |
Revision Date: |
2007-02-28 |
|
|
Tetrapotassium Pyrophosphate Solution |
|
| |
PotashCorp MSDS number: |
75 |
| |
Common Name |
Tetrapotassium Pyrophosphate |
| |
Formula: |
K4O7P2 |
| |
Synonym: |
TKPPFGH, TKPPTG, TKPPTGH |
| |
Use: |
Food Grade, Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid 81-90% Technical Grade |
|
| |
PotashCorp MSDS number: |
78 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
DCHA, DCHA81, DCHA85, DCHA88, DCHA90, IND85, TG85, TG85LS |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid 81-87% Technical Grade |
|
| |
PotashCorp MSDS number: |
79 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
HAA, HAA81 |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid 65-80% Technical Grade |
|
| |
PotashCorp MSDS number: |
80 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
TG70, TG75, TG75LS, TG80, TG80LS, FERT75, DCHA75 |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
| |
PotashCorp MSDS number: |
81 |
| |
Common Name |
Monoaluminium Phosphate Acid |
| |
Formula: |
Al(H2PO4)3 |
| |
Synonym: |
MALP33, MALPTG85 |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-03-09 |
|
|
Dipotassium Phophate Solution |
|
| |
PotashCorp MSDS number: |
85 |
| |
Common Name |
Dipotassium Phosphate |
| |
Formula: |
K2HPO4 |
| |
Synonym: |
DKPFG, DKPFGHPH, DKPTGHPH, DKPTGLPH |
| |
Use: |
Food Grade, Industrial |
| |
Revision Date: |
2008-04-14 |
|
|
Phosphoric Acid 65-80% Food Grade |
|
| |
PotashCorp MSDS number: |
87 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
DCMA75, FG65LS, FG75, FG75LS, FG80, FG80LS |
| |
Use: |
Food Grade, Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid 85-90% Food Grade |
|
| |
PotashCorp MSDS number: |
88 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
DCMA, DCMA85, FG85, FG85LS, LAA, LAALS |
| |
Use: |
Food Grade, Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
Phosphoric Acid 40-60% Technical Grade |
|
| |
PotashCorp MSDS number: |
97 |
| |
Common Name |
Phosphoric Acid |
| |
Formula: |
H3PO4 |
| |
Synonym: |
TG40, TG55 |
| |
Use: |
Industrial |
| |
Revision Date: |
2007-02-28 |
|
|
|